Tubuloside B
Request a quote| Catalog Number | ACM112516048 |
| Product Name | Tubuloside B |
| CAS Number | 112516-04-8 |
| Structure |  |
| Description | Tubuloside B, one of the phenylethanoids isolated from the stems of Cistanche salsa, inhibits TNFα-induced apoptosis. Tubuloside B possesses antioxidative effects. |
| Molecular Weight | 666.62 |
| Molecular Formula | C31H38O16 |
| Canonical SMILES | CC(O[C@@H]([C@@H](O1)OCCC(C=C2)=CC(O)=C2O)[C@H]([C@@H]([C@H]1COC(/C=C/C(C=C3)=CC(O)=C3O)=O)O)O[C@H](O[C@H]4C)[C@@H]([C@@H]([C@H]4O)O)O)=O |
| Purity | 98% |
| Appearance | Solid |
| Storage | 4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light). |
Ask Your Question
