Tripropylene Glycol
Request a quote| Catalog Number | ACM24800440-1 |
| Product Name | Tripropylene Glycol |
| CAS Number | 24800-44-0 |
| Structure |  |
| Description | The polymer product is a hydrophobic material that is insoluble in water or other polar solvents. |
| IUPAC Name | 2-[2-(2-Hydroxypropoxy)propoxy]propan-1-ol |
| Synonyms | ((Methylethylene)Bis(Oxy))Dipropanol |
| Molecular Weight | 192.25 |
| Molecular Formula | C9H20O4 |
| Canonical SMILES | CC(CO)OCC(C)OCC(C)O |
| Inchi | LCZVSXRMYJUNFX-UHFFFAOYSA-N |
| InChIKey | InChI=1S/C9H20O4/c1-7(11)5-12-9(3)6-13-8(2)4-10/h7-11H,4-6H2,1-3H3 |
| Boiling Point | 273 °C (lit.) |
| Melting Point | -45 °C |
| Flash Point | 131.2ºC |
| Purity | 96% |
| Density | 1.021g/ml |
| Appearance | colorless liquid |
| Application | Our hydrophobic polymers are used as coatings, adhesives, fibers, films and engineering plastics. Furthermore, they are widely used as biomedical polymers for vascular grafts, implants and ophthalmic applications. |
| Physical State | Liquid |
| Refractive Index | n20/D 1.444 (lit.) |
Ask Your Question
