Trimethylolpropane Trimethacrylate
Request a quote| Catalog Number | ACM3290924-3 |
| Product Name | Trimethylolpropane Trimethacrylate |
| CAS Number | 3290-92-4 |
| Structure |  |
| Description | Trimethylolpropane trimethacrylate is a crosslinking agent. |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate |
| Synonyms | Tmptma |
| Molecular Weight | 338.40 |
| Molecular Formula | C18H26O6 |
| Canonical SMILES | CCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| Inchi | 1S/C18H26O6/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7/h2,4,6,8-11H2,1,3,5,7H3 |
| InChIKey | OKKRPWIIYQTPQF-UHFFFAOYSA-N |
| Boiling Point | 185°C |
| Melting Point | -25°C |
| Flash Point | >110°C |
| Purity | 90% |
| Density | 1.06 |
| Solubility | water, 1.297 mg/L @ 25 °C (est) |
| Appearance | Yellow liquid |
| Application | Trimethylolpropane trimethacrylate is used in the preparation of macroporous poly (glycidyl methacrylate-co-trimethylolpropane trimethacrylate) materials with fine controlled porous properties. |
| Physical State | Liquid |
| Refractive Index | 1.472 |
Ask Your Question
