Triethylene Glycol Diacetate
Request a quote| Catalog Number | ACM111217-2 |
| Product Name | Triethylene Glycol Diacetate |
| CAS Number | 111-21-7 |
| Structure |  |
| Description | Triethylene glycol diacetate is an odorless clear colorless liquid. (NTP, 1992) |
| IUPAC Name | 2-[2-(2-Acetyloxyethoxy)ethoxy]ethyl acetate |
| Synonyms | Ethanol, 2,2'-ethylenedioxydi-, diacetate |
| Molecular Weight | 234.25 |
| Molecular Formula | C10H18O6 |
| Canonical SMILES | CC(=O)OCCOCCOCCOC(=O)C |
| Inchi | InChI=1S/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| InChIKey | OVOUKWFJRHALDD-UHFFFAOYSA-N |
| Boiling Point | 286 °C at 760 mmHg |
| Melting Point | -50 °C |
| Flash Point | 174 °C |
| Purity | 98% |
| Density | 1,12 g/mL |
| Solubility | greater than or equal to 100 mg/mL at 68° F (NTP, 1992);MISCIBLE WITH ALCOHOL, ETHER;Very soluble in water, ethyl ether, and ethanol. |
| Physical State | Liquid |
| Refractive Index | INDEX OF REFRACTION: 1.437 AT 25 °C |
Ask Your Question
