Thymol
Request a quote| Catalog Number | ACM89838 |
| Product Name | Thymol |
| CAS Number | 89-83-8 |
| Structure |  |
| Description | Thymol is the main monoterpene phenol occurring in essential oils isolated from plants belonging to the Lamiaceae family, and other plants such as those belonging to the Verbenaceae, Scrophulariaceae, Ranunculaceae and Apiaceae families. Thymol has antioxidant, anti-inflammatory, antibacterial and antifungal effects. |
| IUPAC Name | 5-Methyl-2-propan-2-ylphenol |
| Synonyms | 2-Isopropyl-5-methyl-pheno |
| Molecular Weight | 150.22 |
| Molecular Formula | C10H14O |
| Canonical SMILES | CC1=CC(=C(C=C1)C(C)C)O |
| Inchi | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h4-7,11H,1-3H3 |
| InChIKey | MGSRCZKZVOBKFT-UHFFFAOYSA-N |
| Boiling Point | 232 °C(lit.) |
| Melting Point | 48-51 °C(lit.) |
| Flash Point | 216 °F |
| Purity | 98% |
| Density | 0.965 g/mL at 25 °C(lit.) |
| Solubility | Slightly soluble in water, soluble in oils |
| Appearance | Solid |
| Storage | 2-8 °C |
| Physical State | Crystals or crystalline powder |
| Refractive Index | n20/D 1.5227 |
Ask Your Question
