Sucrose
Request a quote| Catalog Number | ACM57501-1 |
| Product Name | Sucrose |
| CAS Number | 57-50-1 |
| Structure |  |
| Description | Sucrose is a type of sugar that is found naturally in sugarcane, sugar beets, and other plants. It is a disaccharide, which means that it is composed of two simpler sugars bonded together: glucose and fructose. |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-Dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Synonyms | Amerfond |
| Molecular Weight | 342.3 |
| Molecular Formula | C12H22O11 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
| Inchi | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| Boiling Point | 397.76 °C |
| Melting Point | 185-187 °C(lit.) |
| Flash Point | 93.3 °C |
| Purity | 99% |
| Density | 1.5805 g/cm³ |
| Solubility | Very soluble in water, slightly soluble in ethanol, insoluble in ethyl ether |
| Appearance | White liquid |
| Application | 1. Sweetener: Sucrose is widely used as a sweetener in food and beverages. 2. Preservation: It can be used as a preservative in jams, jellies, and other preserves. 3. Baking: Sucrose is used in baking to provide texture and volume to baked goods. 4. Fermentation: It is also used in fermentation processes to produce alcoholic beverages such as beer and wine. 5. Medicine: Sucrose can be used as an ingredient in some medications to improve the taste of the medicine. 6. Energy: Sucrose is a source of energy and is used in sports drinks and energy bars. 7. Beauty: Sucrose can be used in beauty products as an exfoliant due to its texture and gentle abrasive properties. 8. Agriculture: Sucrose is used in agriculture as a source of energy for crops during photosynthesis. |
| Storage | Inert atmosphere, room temperature |
| Physical State | Liquid |
| Refractive Index | 66.5 ° (C=26, H₂O) |
Ask Your Question
