Sennidin A
Request a quote| Catalog Number | ACM641123-1 |
| Product Name | Sennidin A |
| CAS Number | 641-12-3 |
| Structure |  |
| Description | Sennidin A, isolated from the leaves of Cassia angustifolia, inhibits HCV NS3 helicase, with an IC50 of 0.8 μM. Sennidin A induces phosphorylation of Akt and glucose transporter 4 (GLUT4) translocation. Sennidin A stimulates the glucose incorporation. |
| IUPAC Name | 9-(2-carboxy-4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-4,5-dihydroxy-10-oxo-9H-anthracene-2-carboxylic acid |
| Synonyms | (9R, 9'R) - Rel- (+) -9, 9', 10, 10'- Tetrahydro- 4, 4', 5, 5'- tetrahydroxy- 10, 10'- dioxo- [9, 9'- Bianthracene] - 2, 2'- dicarboxylic acid |
| Molecular Weight | 538.46 |
| Molecular Formula | C30H18O10 |
| Canonical SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C5=C(C(=CC=C5)O)C(=O)C6=C4C=C(C=C6O)C(=O)O)C=C(C=C3O)C(=O)O |
| Inchi | InChI=1S/C30H18O10/c31-17-5-1-3-13-21(15-7-11(29(37)38)9-19(33)25(15)27(35)23(13)17)22-14-4-2-6-18(32)24(14)28(36)26-16(22)8-12(30(39)40)10-20(26)34/h1-10,21-22,31-34H,(H,37,38)(H,39,40) |
| InChIKey | JPMRHWLJLNKRTJ-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Solid |
Ask Your Question
