Sebacic acid
Request a quote| Catalog Number | ACM111206 |
| Product Name | Sebacic acid |
| CAS Number | 111-20-6 |
| Structure |  |
| Description | Sebacic acid is a white granular powder. Melting point 153°F. Slightly soluble in water. Sublimes slowly at 750 mm Hg when heated to melting point.;DryPowder; DryPowder, PelletsLargeCrystals; OtherSolid; PelletsLargeCrystals;Solid;WHITE POWDER WITH CHARACTERISTIC ODOUR. |
| IUPAC Name | Decanedioic acid |
| Synonyms | 1,10-Decanedioic acid |
| Molecular Weight | 202.25 |
| Molecular Formula | C10H18O4 |
| Inchi | InChI=1S/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14) |
| InChIKey | CXMXRPHRNRROMY-UHFFFAOYSA-N |
| Boiling Point | 294.5 °C/100 mmHg(lit.) |
| Melting Point | 133-137 °C(lit.) |
| Flash Point | 220 °C |
| Purity | 98% |
| Density | 1.21 g/cm³ |
| Solubility | less than 1 mg/mL at 70° F (NTP, 1992);0.00 M;1.0 mg/mL;Solubility in water, g/100ml: 0.1 (poor) |
| Appearance | Solid |
| Storage | Store below +30 °C |
| Physical State | Solid |
| Refractive Index | 1.422 |
Ask Your Question
