Quercetin
Request a quote| Catalog Number | ACM117395 |
| Product Name | Quercetin |
| CAS Number | 117-39-5 |
| Structure |  |
| Description | It is a flavonol found in many fruits, vegetables, leaves and grains. It can be used as an ingredient in supplements, beverages, or foods. |
| IUPAC Name | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| Synonyms | 3,5,7,3',4'-Pentahydroxyflavone |
| Molecular Weight | 302.24 |
| Molecular Formula | C15H10O7 |
| Canonical SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Inchi | InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
| InChIKey | REFJWTPEDVJJIY-UHFFFAOYSA-N |
| Boiling Point | 363.28 °C |
| Melting Point | 316.5 °C |
| Flash Point | 248.1 °C |
| Purity | 95%+ |
| Density | 1.3616 g/cm³ |
| Solubility | Soluble in alcohol, glacial acetic acid, insoluble in water |
| Appearance | Solid |
| Storage | Room temperature |
| Physical State | Solid |
| Refractive Index | 1.4790 |
Ask Your Question
