Psoralen
Request a quote| Catalog Number | ACM66977 |
| Product Name | Psoralen |
| CAS Number | 66-97-7 |
| Structure |  |
| Description | Psoralen (Ficusin) is a coumarin isolated from the seeds of Fructus Psoraleae. Psoralen exhibits a wide range of biological properties, including anti-cancer, antioxidant, antidepressant, anticancer, antibacterial, and antiviral, et al. |
| IUPAC Name | Furo[3,2-g]chromen-7-one |
| Synonyms | 2-Propenoicacid,3-(6-hydroxy-5-benzofuranyl)-,δ-lactone |
| Molecular Weight | 186.16 |
| Molecular Formula | C11H6O3 |
| Canonical SMILES | C1=CC(=O)OC2=CC3=C(C=CO3)C=C21 |
| Inchi | InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
| InChIKey | ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
| Boiling Point | 280.64 °C |
| Melting Point | 160-162 °C |
| Purity | 98% |
| Density | 1.25 g/ml |
| Appearance | White powder |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
