Propyl Gallate
Request a quote| Catalog Number | ACM121799-1 |
| Product Name | Propyl Gallate |
| CAS Number | 121-79-9 |
| Structure |  |
| IUPAC Name | Propyl 3,4,5-trihydroxybenzoate |
| Synonyms | Propylester kyseliny gallove |
| Molecular Weight | 212.2 |
| Molecular Formula | C10H12O5 |
| Canonical SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Inchi | InChI=1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
| InChIKey | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Boiling Point | 312.03 °C |
| Melting Point | 146-149 °C(lit.) |
| Flash Point | 187 °C |
| Purity | 98% |
| Density | 1.210 g/cm³ |
| Solubility | Slightly soluble in acetone and 2-butanol |
| Appearance | White to light beige powder |
| Storage | Store below +30 °C |
| Physical State | Powder |
| Refractive Index | 1.5140 |
Ask Your Question
