Phenethyl Isobutyrate
Request a quote| Catalog Number | ACM103480 |
| CAS | 103-48-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/103-48-0.gif) |
| Description | Phenethyl isobutyrate occurs in peppermint oils. It has a heavy, fruity, blossom odor and is used accordingly in perfume and flavor compositions. |
| IUPAC Name | 2-Phenylethyl 2-methylpropanoate |
| Synonyms | Benzylcarbinyl isobutyrate |
| Molecular Weight | 192.25 |
| Molecular Formula | C12H16O2 |
| Canonical SMILES | CC(C)C(=O)OCCC1=CC=CC=C1 |
| Inchi | InChI=1S/C12H16O2/c1-10(2)12(13)14-9-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | JDQVBGQWADMTAM-UHFFFAOYSA-N |
| Boiling Point | 250 °C |
| Flash Point | 227 °F |
| Purity | 98%+ |
| Density | 0.988 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water; soluble in oils |
| Appearance | Colourless to slighty yellow liquid; fruity-rosy odour |
| Physical State | Liquid |
| Refractive Index | n20/D 1.4873(lit.) |
Ask Your Question
