P-Tolualdehyde
Request a quote| Catalog Number | ACM104870 |
| Product Name | P-Tolualdehyde |
| CAS Number | 104-87-0 |
| Structure |  |
| Description | Liquid;Liquid;Liquid |
| IUPAC Name | 4-methylbenzaldehyde |
| Synonyms | 4-Methylbenzaldehyde |
| Molecular Weight | 120.15 |
| Molecular Formula | C8H8O |
| Canonical SMILES | CC1=CC=C(C=O)C=C1 |
| Inchi | InChI=1S/C8H8O/c1-7-2-4-8(6-9)5-3-7/h2-6H,1H3 |
| InChIKey | FXLOVSHXALFLKQ-UHFFFAOYSA-N |
| Boiling Point | 82-85 °C at 11 mmHg |
| Melting Point | -6°C |
| Flash Point | 80°C |
| Purity | >98.0%(GC) |
| Density | 1.015 |
| Solubility | 0.02 M;2.27 mg/mL at 25 °C;Miscible with ethanol, ethyl ether, acetone; very soluble in chloroform;In water, 2.27X10+3 mg/L at 25 °C;2.27 mg/mL at 25 °C |
| Appearance | Clear to pale yellow liquid |
| Storage | Store under inert gas |
| Refractive Index | 1.542-1.548 |
Ask Your Question
