Octyl Gallate
Request a quote| Catalog Number | ACM1034011 |
| CAS | 1034-01-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/1034-01-1.gif) |
| Description | Octyl gallate (Progallin O) is widely used as a food additive, with antimicrobial and antioxidant activity. Octyl gallate (Progallin O) shows selective and sensitive fluorescent property. Octyl gallate shows a marked antiviral effect against HSV-1, vesicular stomatitis virus (VSV) and poliovirus. |
| IUPAC Name | Octyl 3,4,5-trihydroxybenzoate |
| Synonyms | 3,4,5-Trihydroxy-benzoicacioctylester |
| Molecular Weight | 282.33 |
| Molecular Formula | C15H22O5 |
| Canonical SMILES | CCCCCCCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Inchi | InChI=1S/C15H22O5/c1-2-3-4-5-6-7-8-20-15(19)11-9-12(16)14(18)13(17)10-11/h9-10,16-18H,2-8H2,1H3 |
| InChIKey | NRPKURNSADTHLJ-UHFFFAOYSA-N |
| Boiling Point | 262.5 °C |
| Melting Point | 101-104 °C(lit.) |
| Flash Point | 177.1 °C |
| Purity | 98% |
| Density | 1.0984 g/cm³ |
| Solubility | Insoluble in water, freely soluble in ethanol, ether, propane-1, 2-diol |
| Appearance | Solid |
| Storage | Store below +30 °C |
| Refractive Index | 1.6200 |
Ask Your Question
