Mulberrofuran G
Request a quote| Catalog Number | ACM87085005 |
| Product Name | Mulberrofuran G |
| CAS Number | 87085-00-5 |
| Description | Mulberrofuran G protects ischemic injury-induced cell death via inhibition of NOX4-mediated ROS generation and ER stress. Mulberrofuran G shows moderate inhibiting activity of hepatitis B virus (HBV) DNA replication with IC50 of 3.99 μM. |
| Molecular Weight | 562.6 |
| Molecular Formula | C34H26O8 |
| Canonical SMILES | CC1=CC2C3C(C1)C4=C(C=C(C=C4)O)OC3(OC5=C2C(=CC(=C5)C6=CC7=C(O6)C=C(C=C7)O)O)C8=C(C=C(C=C8)O)O |
| Inchi | InChI=1S/C34H26O8/c1-16-8-23-22-6-4-21(37)15-30(22)41-34(25-7-5-19(35)13-26(25)38)33(23)24(9-16)32-27(39)10-18(12-31(32)42-34)28-11-17-2-3-20(36)14-29(17)40-28/h2-7,9-15,23-24,33,35-39H,8H2,1H3 |
| InChIKey | MJJWBJFYYRAYKU-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
