Methyl Stearate
Request a quote| Catalog Number | ACM112618-1 |
| Product Name | Methyl Stearate |
| CAS Number | 112-61-8 |
| Structure |  |
| Description | off-white to cream or light yellow paste;Methyl stearate is used as a nonionic surfactant in various experiments in helping solubilize a variety of chemical species by dissociating aggregates and unfolding proteins. |
| IUPAC Name | Methyl octadecanoate |
| Synonyms | Methyl ester stearic acid |
| Molecular Weight | 298.5 |
| Molecular Formula | C19H38O2 |
| Canonical SMILES | CCCCCCCCCCCCCCCCCC(=O)OC |
| Inchi | InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| InChIKey | HPEUJPJOZXNMSJ-UHFFFAOYSA-N |
| Boiling Point | 215 °C |
| Melting Point | 37-41 °C(lit.) |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 0.84 g/cm³ |
| Solubility | Soluble in chloroform, insoluble in water |
| Appearance | Solid |
| Storage | -20 °C |
| Physical State | Crystals |
| Refractive Index | 1.4241 |
Ask Your Question
