Methyl Cinnamate
Request a quote| Catalog Number | ACM103264-1 |
| Product Name | Methyl Cinnamate |
| CAS Number | 103-26-4 |
| Structure |  |
| Description | Methyl cinnamate (Methyl 3-phenylpropenoate), an active component of Zanthoxylum armatum, is a widely used natural flavor compound. Methyl cinnamate (Methyl 3-phenylpropenoate) possesses antimicrobial activity and is a tyrosinase inhibitor that can prevent food browning. Methyl cinnamate (Methyl 3-phenylpropenoate) has antiadipogenic activity through mechanisms mediated, in part, by the CaMKK2-AMPK signaling pathway. |
| IUPAC Name | Methyl (E)-3-phenylprop-2-enoate |
| Synonyms | Benzeneacrylic acid methyl ester |
| Molecular Weight | 162.19 |
| Molecular Formula | C10H10O2 |
| Canonical SMILES | COC(=O)C=CC1=CC=CC=C1 |
| Inchi | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
| InChIKey | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
| Boiling Point | 260-262 °C(lit.) |
| Melting Point | 33-38 °C(lit.) |
| Flash Point | >230 °F |
| Purity | 99% |
| Density | 1.092 g/cm³ |
| Solubility | Insoluble in water, soluble in oils |
| Appearance | Liquid |
| Storage | Sealed in dry, room temperature |
| Physical State | Fused crystalline |
| Refractive Index | 1.5771 |
Ask Your Question
