Methyl 4-Hydroxycinnamate
Request a quote| Catalog Number | ACM19367385 |
| Product Name | Methyl 4-Hydroxycinnamate |
| CAS Number | 19367-38-5 |
| Structure |  |
| Description | Methyl 4-hydroxycinnamate is a predicted metabolite generated by BioTransformer1 that is produced by the metabolism of methyl 3-phenylprop-2-enoate. |
| IUPAC Name | Methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| Synonyms | (2E)-3-(4-Hydroxyphenyl)-2-propenoic acid methyl ester |
| Molecular Weight | 178.18 |
| Molecular Formula | C10H10O3 |
| Canonical SMILES | COC(=O)C=CC1=CC=C(C=C1)O |
| Inchi | InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+ |
| InChIKey | NITWSHWHQAQBAW-QPJJXVBHSA-N |
| Boiling Point | 306.6±17.0 °C |
| Melting Point | 138-140 °C |
| Purity | 95%+ |
| Solubility | Slightly soluble in chloroform and methanol |
| Physical State | Powder |
Ask Your Question
