Maltotriose
Request a quote| Catalog Number | ACM1109280 |
| Product Name | Maltotriose |
| CAS Number | 1109-28-0 |
| Structure |  |
| Description | Maltotriose is a trisaccharide (three-part sugar) consisting of three glucose molecules linked with α-1,4 glycosidic bonds.It is most commonly produced by the digestive enzyme alpha-amylase (a common enzyme in human saliva) on amylose in starch. The creation of both maltotriose and maltose during this process is due to the random manner in which alpha amylase hydrolyses α-1,4 glycosidic bonds.It is the shortest chain oligosaccharide that can be classified as maltodextrin. |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-Dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Synonyms | 4-O-[4-O-(α-D-Glucopyranosyl)-α-D-glucopyranosyl]-D-glucose |
| Molecular Weight | 504.44 |
| Molecular Formula | C18H32O16 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Inchi | InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17-,18-/m1/s1 |
| InChIKey | FYGDTMLNYKFZSV-DZOUCCHMSA-N |
| Boiling Point | 513.84 °C |
| Melting Point | 132-135 °C |
| Flash Point | 477 °C |
| Purity | 98% |
| Density | 1.4403 g/cm³ |
| Solubility | Soluble in water |
| Appearance | White to off-white powder |
| Storage | Sealed in dry, 2-8 °C |
| Refractive Index | 1.6760 |
Ask Your Question
