Leachianone G
Request a quote| Catalog Number | ACM152464783 |
| Product Name | Leachianone G |
| CAS Number | 152464-78-3 |
| Structure |  |
| Description | Leachianone G is an antiviral flavonoid from the root bark of Morus alba L. Leachianone G shows potent antiviral activity against herpes simplex type 1 virus (HSV-1) with an IC50 value of 1.6 μg/mL. |
| IUPAC Name | (2S)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| Molecular Weight | 356.4 |
| Molecular Formula | C20H20O6 |
| Canonical SMILES | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=C(C=C(C=C3)O)O)O)O)C |
| Inchi | InChI=1S/C20H20O6/c1-10(2)3-5-13-15(23)8-16(24)19-17(25)9-18(26-20(13)19)12-6-4-11(21)7-14(12)22/h3-4,6-8,18,21-24H,5,9H2,1-2H3/t18-/m0/s1 |
| InChIKey | VBOYLFNGTSLAAZ-SFHVURJKSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
