Lauric Acid
Request a quote| Catalog Number | ACM143077-2 |
| Product Name | Lauric Acid |
| CAS Number | 143-07-7 |
| Structure |  |
| Description | Lauric acid is a white solid with a slight odor of bay oil. (USCG, 1999);DryPowder; Liquid; OtherSolid; OtherSolid, Liquid;Liquid;Solid;white or faintly yellowish crystalline solid |
| IUPAC Name | Dodecanoic acid |
| Synonyms | Dodecylicacid |
| Molecular Weight | 200.32 |
| Molecular Formula | C12H24O2 |
| Canonical SMILES | CCCCCCCCCCCC(=O)O |
| Inchi | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
| InChIKey | POULHZVOKOAJMA-UHFFFAOYSA-N |
| Boiling Point | 225 °C/100 mmHg(lit.) |
| Melting Point | 44-46 °C(lit.) |
| Flash Point | >230 °F |
| Purity | 99% |
| Density | 0.883 g/mL at 25 °C(lit.) |
| Solubility | Practically insoluble in water, soluble in alcohol, chloroform, ether |
| Appearance | Solid |
| Storage | 2-8 °C |
| Physical State | Crystalline powder of flakes |
| Refractive Index | 1.4304 |
Ask Your Question
