Lapachol
Request a quote| Catalog Number | ACM84797 |
| Product Name | Lapachol |
| CAS Number | 84-79-7 |
| Structure |  |
| Description | Lapachol is a naphthoquinone that was first isolated from Tabebuia avellanedae (Bignoniaceae). Lapachol shows anti-abscess, anti-ulcer, antileishmanial, anticarcinomic, antiedemic, anti-inflammatory, antimalarial, antiseptic, antitumor, antiviral, antibacterial, antifungal and pesticidal activities. |
| IUPAC Name | 4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione |
| Synonyms | Greenhartin |
| Molecular Weight | 242.27 |
| Molecular Formula | C15H14O3 |
| Canonical SMILES | CC(=CCC1=C(C2=CC=CC=C2C(=O)C1=O)O)C |
| Inchi | InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,16H,8H2,1-2H3 |
| InChIKey | CWPGNVFCJOPXFB-UHFFFAOYSA-N |
| Boiling Point | 390.1±42.0 °C at 760 mmHg |
| Melting Point | 141-143 ºC(lit.) |
| Flash Point | 203.9±24.4 °C |
| Purity | 97% |
| Density | 1.2±0.1 g/cm3 |
| Appearance | Yellow powder |
| Refractive Index | 1.606 |
Ask Your Question
