Isopropyl Myristate
Request a quote| Catalog Number | ACM110270 |
| Product Name | Isopropyl Myristate |
| CAS Number | 110-27-0 |
| Structure |  |
| Description | Ester of isopropyl alcohol and myristic acid (vegetable-derived). Low viscosity fluid non-greasy emollient, tolerates wide pH range, compatible with most surfactants. Thanks to its low viscosity and density, it has a high spreadability. Specific gravity 0.85 (at 20°C). |
| IUPAC Name | Propan-2-yl tetradecanoate |
| Synonyms | 1-Methylethyl tetradecanoate |
| Molecular Weight | 270.5 |
| Molecular Formula | C17H34O2 |
| Canonical SMILES | CCCCCCCCCCCCCC(=O)OC(C)C |
| Inchi | InChI=1S/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3/h16H,4-15H2,1-3H3 |
| InChIKey | AXISYYRBXTVTFY-UHFFFAOYSA-N |
| Boiling Point | 193 °C |
| Melting Point | 3 °C |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 0.85 g/mL at 25 °C(lit.) |
| Solubility | Water-insoluble, but soluble with silicones, and hydrocarbons |
| Appearance | Colorless oil-like liquid, odorless |
| Application | Creams, lotions, hand creams, shampoo, shower gels, makeup removers, powders and foundations. |
| Storage | Store in a closed container at a dry place at room temperature |
| Physical State | Liquid |
| Refractive Index | n20/D 1.434(lit.) |
Ask Your Question
