Isolongifolene
Request a quote| Catalog Number | ACM1135666 |
| Product Name | Isolongifolene |
| CAS Number | 1135-66-6 |
| Structure |  |
| Description | Isolongifolene ((-)-Isolongifolene) is a tricyclic sesquiterpene isolated from Murraya koenigii. Isolongifolene attenuates Rotenone-induced oxidative stress, mitochondrial dysfunction and apoptosis through the regulation of PI3K/AKT/GSK-3β signaling pathways. Isolongifolene has antioxidant, anti-inflammatory, anticancer and neuroprotective properties. |
| IUPAC Name | (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.01,6]undec-5-ene |
| Synonyms | (2S,4aR)-1,2,3,4,4a,5,6,7-Octahydro-1,1,5,5-tetramethyl-2,4a-methanonaphthalene |
| Molecular Weight | 204.35 |
| Molecular Formula | C15H24 |
| Canonical SMILES | CC1(C)[C@]23CC[C@](C3)([H])C(C)(C)C2=CCC1 |
| Inchi | InChI=1S/C15H24/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h6,11H,5,7-10H2,1-4H3/t11-,15-/m0/s1 |
| InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
| Boiling Point | 255-256 °C |
| Flash Point | 49 °C |
| Purity | 95% |
| Density | 0.930 g/mL at 20 °C(lit.) |
| Appearance | Colorless or light yellow liquid |
| Storage | Pure form-20°C,3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
| Refractive Index | n20/D 1.499(lit.) |
Ask Your Question
