Isoliquiritigenin
Request a quote| Catalog Number | ACM961295 |
| Product Name | Isoliquiritigenin |
| CAS Number | 961-29-5 |
| Structure |  |
| Description | Isoliquiritigenin is an anti-tumor flavonoid from the root of Glycyrrhiza uralensis Fisch., which inhibits aldose reductase with an IC50 of 320 nM. Isoliquiritigenin is a potent inhibitor of influenza virus replication with an EC50 of 24.7 μM. |
| IUPAC Name | (E)-1-(2,4-Dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | 2',4,4'-Trihydroxy-trans-chalcone |
| Molecular Weight | 256.25 |
| Molecular Formula | C15H12O4 |
| Canonical SMILES | C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O |
| Inchi | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3+ |
| InChIKey | DXDRHHKMWQZJHT-FPYGCLRLSA-N |
| Boiling Point | 504.0±42.0 °C |
| Melting Point | 206-210 °C |
| Purity | 98% |
| Density | 1.384±0.06 g/cm³ |
| Appearance | Yellow to orange powder |
| Storage | 2-8 °C |
Ask Your Question
