Illudin S
Request a quote| Catalog Number | ACM1149991 |
| Product Name | Illudin S |
| CAS Number | 1149-99-1 |
| Structure |  |
| Description | Illudin S is a fungal sesquiterpene that, through their unique DNA alkylating actions, have anticancer potential. Illudin S is a cytotoxic illudin that is converted, intracellularly, to metabolites that cause a complete block of cell cycling at the G1-S phase interface, particularly in myeloid and T-lymphocyte leukemia cells (IC50 = 6-11 nM). T-lymphocyte leukemia CEM cells that are resistant to doxorubicin (Item No. 15007), epipodophyllotoxins, and 1-β-D-arabinofuranosylcytosine display only 2-fold increased resistance to illudin S. Illudin S metabolites induce DNA damage that is not repaired by the processes that counter conventional DNA alkylating agents. |
| IUPAC Name | (2'S,3'R,6'R)-3',6'-dihydroxy-2'-(hydroxymethyl)-2',4',6'-trimethyl-2',3'-dihydrospiro[cyclopropane-1,5'-inden]-7'(6'H)-one |
| Synonyms | Illudin S; DR-15978; DR 15978; DR15978; NSC 626369; NSC-626369; NSC626369; Lunamycin; Lampterol |
| Molecular Weight | 264.32 |
| Molecular Formula | C15H20O4 |
| Canonical SMILES | CC1=C2[C@H]([C@](CO)(C=C2C([C@](O)(C13CC3)C)=O)C)O |
| Inchi | InChI=1S/C15H20O4/c1-8-10-9(6-13(2,7-16)12(10)18)11(17)14(3,19)15(8)4-5-15/h6,12,16,18-19H,4-5,7H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | DDLLIYKVDWPHJI-RDBSUJKOSA-N |
| Melting Point | 124-126°C |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Shelf Life | >3 years if stored properly |
| Storage | Dry, dark and at 0-4 °C for short term (days to weeks) or -20 °C for long term (months to years). |
Ask Your Question
