Hypocrellin B
Request a quote| Catalog Number | ACM123940545 |
| Product Name | Hypocrellin B |
| CAS Number | 123940-54-5 |
| Structure |  |
| Description | Hypocrellin B, a pigment isolated from the fungi Hypocrella bambusae and Shiraia bambusicola, is an apoptosis inducer. Hypocrellin B can be used as a photosensitizer for photodynamic therapy of cancer. Hypocrellin B also has antimicrobial and antileishmanial activities. |
| IUPAC Name | 12-Acetyl-9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione |
| Synonyms | HC-B |
| Molecular Weight | 528.51 |
| Molecular Formula | C30H24O9 |
| Canonical SMILES | CC1=C(C2=C3C4=C(C1)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C |
| Inchi | InChI=1S/C30H24O9/c1-10-7-12-18-23-19(27(34)29(12)38-5)13(32)8-15(36-3)21(23)22-16(37-4)9-14(33)20-25(22)24(18)26(17(10)11(2)31)30(39-6)28(20)35/h8-9,34-35H,7H2,1-6H3 |
| InChIKey | SBMXTMAIKRQSQE-UHFFFAOYSA-N |
| Boiling Point | 893.8±65.0 °C |
| Melting Point | 261-263 °C |
| Purity | 98% |
| Density | 1.52±0.1 g/ml |
| Appearance | Powder |
| Physical State | Solid |
Ask Your Question
