Homogentisic Acid
Request a quote| Catalog Number | ACM451138 |
| CAS | 451-13-8 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/451-13-8.gif) |
| Description | Homogentisic acid (2,5-dihydroxyphenylacetic acid) is a phenolic acid found in Arbutus unedo (strawberry-tree) honey. It is also present in the bacterial plant pathogen Xanthomonas campestris pv. phaseoli as well as in the yeast Yarrowia lipolytica where it is associated with the production of brown pigments.It is less commonly known as melanic acid, the name chosen by William Prout. |
| IUPAC Name | 2-(2,5-Dihydroxyphenyl)acetic acid |
| Synonyms | Alcapton |
| Molecular Weight | 168.15 |
| Molecular Formula | C8H8O4 |
| Canonical SMILES | C1=CC(=C(C=C1O)CC(=O)O)O |
| Inchi | InChI=1S/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
| InChIKey | IGMNYECMUMZDDF-UHFFFAOYSA-N |
| Boiling Point | 257.07 °C |
| Melting Point | 150-152 °C(lit.) |
| Flash Point | 233.6 °C |
| Purity | 97% |
| Density | 1.3037 g/cm³ |
| Solubility | Soluble in methanol |
| Appearance | Crystalline |
| Storage | 2-8 °C |
| Refractive Index | 1.5090 |
Ask Your Question
