Heptyl Acetate
Request a quote| Catalog Number | ACM112061 |
| Product Name | Heptyl Acetate |
| CAS Number | 112-06-1 |
| Structure |  |
| Description | Heptyl acetate has a pleasant odor suggestive of pear (rose) and a sweet, apricot-like taste. |
| IUPAC Name | heptyl acetate |
| Synonyms | 1-Heptyl acetate |
| Molecular Weight | 158.2 |
| Molecular Formula | C9H18O2 |
| Canonical SMILES | CCCCCCCOC(=O)C |
| Inchi | InChI=1S/C9H18O2/c1-3-4-5-6-7-8-11-9(2)10/h3-8H2,1-2H3 |
| InChIKey | ZCZSIDMEHXZRLG-UHFFFAOYSA-N |
| Boiling Point | 192-193℃ |
| Melting Point | -50°C |
| Flash Point | 68.6°C |
| Purity | 98% |
| Density | 0.87 g/cm³ |
| Solubility | water, 101.9 mg/L @ 25 °C (est) |
| Appearance | Oil |
| Physical State | Liquid |
| Refractive Index | n20/D 1.414 |
Ask Your Question
