Heptane-3,5-Dione
Request a quote| Catalog Number | ACM7424546 |
| Product Name | Heptane-3,5-Dione |
| CAS Number | 7424-54-6 |
| Structure |  |
| IUPAC Name | heptane-3,5-dione; |
| Synonyms | FT-0614742; 3,5-Heptanedione, 99%; InChI=1/C7H12O2/c1-3-6(8)5-7(9)4-2/h3-5H2,1-2H; RT-004211; KS-00000NF5; CS-W013466; 3,5-Heptanedione, 97%; M-4998; ACT02985; MCULE-9368471361; |
| Molecular Weight | 128.17 |
| Molecular Formula | C7H12O2 |
| Canonical SMILES | CCC(=O)CC(=O)CC; |
| Inchi | InChI=1S/C7H12O2/c1-3-6(8)5-7(9)4-2/h3-5H2,1-2H3; |
| InChIKey | DGCTVLNZTFDPDJ-UHFFFAOYSA-N; |
| Boiling Point | 183.1 °C at 760 mmHg |
| Purity | 97% |
| Application | Enantioselective conjugate addition of 1,3-dicarbonyls to nitroolefins via nickel (II)-diamine catalysis.1 |
Ask Your Question
