Glycerol
Request a quote| Catalog Number | ACM56815 |
| Product Name | Glycerol |
| CAS Number | 56-81-5 |
| Structure |  |
| Description | Glycerol (also called glycerine or glycerin; see spelling differences) is a simple polyol compound. It is a colorless, odorless, viscous liquid that is sweet-tasting and non-toxic. The glycerol backbone is found in all lipids known as triglycerides. It is widely used in the food industry as a sweetener and humectant and in pharmaceutical formulations. Glycerol has three hydroxyl groups that are responsible for its solubility in water and its hygroscopic nature. |
| IUPAC Name | Propane-1,2,3-triol |
| Synonyms | Glycerin(mist) |
| Molecular Weight | 92.09 |
| Molecular Formula | C3H8O3 |
| Canonical SMILES | C(C(CO)O)O |
| Inchi | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| InChIKey | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Boiling Point | 290 °C |
| Melting Point | 20 °C(lit.) |
| Flash Point | 320 °F |
| Purity | 99%+ |
| Density | 1.25 g/mL(lit.) |
| Solubility | Insoluble in fixed, volatile oils |
| Appearance | Liquid |
| Storage | 5-30 °C |
| Physical State | Viscous liquid |
| Refractive Index | n20/D 1.474(lit.) |
Ask Your Question
