Geraniol
Request a quote| Catalog Number | ACM106241 |
| Product Name | Geraniol |
| CAS Number | 106-24-1 |
| Structure |  |
| Description | Geraniol, an olefinic terpene, was found to inhibit growth of Candida albicans and Saccharomyces cerevisiae strains. |
| IUPAC Name | (2E)-3,7-Dimethylocta-2,6-dien-1-ol |
| Synonyms | Geranyl alcohol |
| Molecular Weight | 154.25 |
| Molecular Formula | C10H18O |
| Canonical SMILES | CC(=CCCC(=CCO)C)C |
| Inchi | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | GLZPCOQZEFWAFX-JXMROGBWSA-N |
| Boiling Point | 229-230 °C |
| Melting Point | -15 °C |
| Flash Point | 216 °F |
| Purity | 99%+ |
| Density | 0.879 g/mL at 20 °C(lit.) |
| Solubility | Slightly soluble in water |
| Appearance | Oil |
| Physical State | Liquid |
| Refractive Index | n20/D 1.474(lit.) |
Ask Your Question
