Furowanin A
Request a quote| Catalog Number | ACM911004723 |
| Product Name | Furowanin A |
| CAS Number | 911004-72-3 |
| Structure |  |
| Description | Furowanin A is a flavonoid with anti-neoplastic effects. Furowanin A inhibits STAT3/Mcl-1 axis to suppress proliferation, block cell cycle progression, induce apoptosis and promote autophagy. Furowanin A potently inhibits colorectal cancer (CRC) cells. |
| IUPAC Name | 6-(3,4-dihydroxyphenyl)-4-hydroxy-2-(2-hydroxypropan-2-yl)-9-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-g]chromen-5-one |
| Molecular Weight | 438.5 |
| Molecular Formula | C25H26O7 |
| Canonical SMILES | CC(=CCC1=C2C(=C(C3=C1OC=C(C3=O)C4=CC(=C(C=C4)O)O)O)CC(O2)C(C)(C)O)C |
| Inchi | InChI=1S/C25H26O7/c1-12(2)5-7-14-23-15(10-19(32-23)25(3,4)30)21(28)20-22(29)16(11-31-24(14)20)13-6-8-17(26)18(27)9-13/h5-6,8-9,11,19,26-28,30H,7,10H2,1-4H3 |
| InChIKey | NMEQUFXTRAXRGN-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
