Fucoxanthin
Request a quote| Catalog Number | ACM3351868 |
| Product Name | Fucoxanthin |
| CAS Number | 3351-86-8 |
| Structure |  |
| Description | Fucoxanthin is a naturally occurring compound found in brown seaweed, such as wakame, hijiki, and brown algae. It is a type of carotenoid and is known for its antioxidant properties. Fucoxanthin has been shown to have potential anti-inflammatory, anti-tumor, and anti-obesity effects. |
| IUPAC Name | [(1S,3R)-3-hydroxy-4-[(3E,5E,7E,9E,11E,13E,15E)-18-[(1R,3S,6S)-3-hydroxy-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-6-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,5,5-trimethylcyclohexyl] acetate |
| Synonyms | (3S,3'S,5R,5'R,6S,6'R)-6',7'-Didehydro-5,6-epoxy-4',5',6,7-tetrahydro-3,3',5'-trihydroxy-,-caroten-8(5H)-one |
| Molecular Weight | 658.9 |
| Molecular Formula | C42H58O6 |
| Canonical SMILES | CC(=CC=CC=C(C)C=CC=C(C)C(=O)CC12C(CC(CC1(O2)C)O)(C)C)C=CC=C(C)C=C=C3C(CC(CC3(C)O)OC(=O)C)(C)C |
| Inchi | InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23,34-,35-,40+,41+,42-/m0/s1 |
| InChIKey | SJWWTRQNNRNTPU-ABBNZJFMSA-N |
| Boiling Point | 590.43 °C |
| Melting Point | 166-168 °C |
| Purity | 95%+ |
| Density | 1.09 g/cm³ |
| Solubility | Soluble in ethanol |
| Appearance | Powder |
| Application | 1. Fucoxanthin is a brown seaweed pigment that is used as a dietary supplement to promote weight loss. 2. It has anti-inflammatory properties and may help reduce the risk of chronic diseases such as cancer and heart disease. 3. Fucoxanthin may also have potential as a natural food preservative due to its antioxidant properties. 4. Studies have shown that fucoxanthin may improve insulin sensitivity and help regulate blood sugar levels. 5. It has been found to have antibacterial and antiviral properties and may be useful in the development of new treatments for infections. |
| Physical State | Powder |
| Refractive Index | n20/D 1.360-1.362 |
Ask Your Question
