What is the molecular formula of Fucoxanthin?

The molecular formula of Fucoxanthin is C42H58O6.

What is the molecular weight of Fucoxanthin?

The molecular weight of Fucoxanthin is 658.9 g/mol.

What are the synonyms for Fucoxanthin?

The synonyms for Fucoxanthin include Fucoxanthin 3351-86-8 and all-trans-Fucoxanthin.

What are the properties of Fucoxanthin?

Fucoxanthin exhibits anti-cancer, anti-diabetic, anti-oxidative, and neuroprotective properties.

Where is Fucoxanthin found?

Fucoxanthin is found in brown seaweed and other organisms such as Aequipecten opercularis and Ascidia zara.

What is the InChIKey of Fucoxanthin?

The InChIKey of Fucoxanthin is SJWWTRQNNRNTPU-ABBNZJFMSA-N.

What is the CAS number of Fucoxanthin?

The CAS number of Fucoxanthin is 3351-86-8.

What is the KEGG ID of Fucoxanthin?

The KEGG ID of Fucoxanthin is C08596.

What is the XLogP3-AA value of Fucoxanthin?

The XLogP3-AA value of Fucoxanthin is 8.1.

What are the computed properties of Fucoxanthin?

The computed properties of Fucoxanthin include its molecular weight (658.9 g/mol), XLogP3-AA value (8.1), hydrogen bond donor count (2), hydrogen bond acceptor count (6), rotatable bond count (12), and exact mass (658.42333957 g/mol).

CAS 3351-86-8 Fucoxanthin - Carboxyl / Alfa Chemistry

Name: Fucoxanthin
SKU: ACM3351868
Rating: 5 (1 reviews)

Catalog Number	ACM3351868
CAS	3351-86-8
Structure
Description	Fucoxanthin is a naturally occurring compound found in brown seaweed, such as wakame, hijiki, and brown algae. It is a type of carotenoid and is known for its antioxidant properties. Fucoxanthin has been shown to have potential anti-inflammatory, anti-tumor, and anti-obesity effects.
IUPAC Name	[(1S,3R)-3-hydroxy-4-[(3E,5E,7E,9E,11E,13E,15E)-18-[(1R,3S,6S)-3-hydroxy-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-6-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,5,5-trimethylcyclohexyl] acetate
Synonyms	(3S,3'S,5R,5'R,6S,6'R)-6',7'-Didehydro-5,6-epoxy-4',5',6,7-tetrahydro-3,3',5'-trihydroxy-,-caroten-8(5H)-one
Molecular Weight	658.9
Molecular Formula	C42H58O6
Canonical SMILES	CC(=CC=CC=C(C)C=CC=C(C)C(=O)CC12C(CC(CC1(O2)C)O)(C)C)C=CC=C(C)C=C=C3C(CC(CC3(C)O)OC(=O)C)(C)C
Inchi	InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23,34-,35-,40+,41+,42-/m0/s1
InChIKey	SJWWTRQNNRNTPU-ABBNZJFMSA-N
Boiling Point	590.43 °C
Melting Point	166-168 °C
Purity	95%+
Density	1.09 g/cm³
Solubility	Soluble in ethanol
Appearance	Powder
Application	1. Fucoxanthin is a brown seaweed pigment that is used as a dietary supplement to promote weight loss. 2. It has anti-inflammatory properties and may help reduce the risk of chronic diseases such as cancer and heart disease. 3. Fucoxanthin may also have potential as a natural food preservative due to its antioxidant properties. 4. Studies have shown that fucoxanthin may improve insulin sensitivity and help regulate blood sugar levels. 5. It has been found to have antibacterial and antiviral properties and may be useful in the development of new treatments for infections.
Physical State	Powder
Refractive Index	n20/D 1.360-1.362