What is the CAS number of Dl-Mevalonolactone?

The CAS number of Dl-Mevalonolactone is 674-26-0.

What are some synonyms for Dl-Mevalonolactone?

Some synonyms for Dl-Mevalonolactone are (±)-3-Hydroxy-3-Methyl Δ-Valerolactone and 4-Hydroxy-4-methyloxan-2-one.

What is the molecular weight of Dl-Mevalonolactone?

The molecular weight of Dl-Mevalonolactone is 130.14.

What is the molecular formula of Dl-Mevalonolactone?

The molecular formula of Dl-Mevalonolactone is C6H10O3.

What is the InChI of Dl-Mevalonolactone?

The InChI of Dl-Mevalonolactone is InChI=1S/C6H10O3/c1-6(8)2-3-9-5(7)4-6/h8H,2-4H2,1H3.

What is the boiling point of Dl-Mevalonolactone?

The boiling point of Dl-Mevalonolactone is 145-150 °C at 5 mmHg.

What is the melting point of Dl-Mevalonolactone?

The melting point of Dl-Mevalonolactone is 28 °C.

What is the purity percentage of Dl-Mevalonolactone?

The purity of Dl-Mevalonolactone is 97%.

How should Dl-Mevalonolactone be stored?

Dl-Mevalonolactone should be stored at 0-10°C.

What are the typical applications of Dl-Mevalonolactone?

Some typical applications of Dl-Mevalonolactone include its use as a dispersing agent and emulsion stabilizer.

CAS 674-26-0 Dl-Mevalonolactone - Carboxyl / Alfa Chemistry

Name: Dl-Mevalonolactone
SKU: ACM674260
Rating: 5 (1 reviews)

Catalog Number	ACM674260
CAS	674-26-0
Structure
IUPAC Name	4-Hydroxy-4-methyloxan-2-one
Synonyms	Tetrahydro-4-hydroxy-4-methylpyran-2-one
Molecular Weight	130.14
Molecular Formula	C6H10O3
Canonical SMILES	CC1(CCOC(=O)C1)O
Inchi	InChI=1S/C6H10O3/c1-6(8)2-3-9-5(7)4-6/h8H,2-4H2,1H3
InChIKey	JYVXNLLUYHCIIH-UHFFFAOYSA-N
Boiling Point	145-150 °C/5 mmHg(lit.)
Melting Point	28 °C(lit.)
Flash Point	>230 °F
Purity	95%+
Density	1.1066 g/cm³
Solubility	water, 1e+006 mg/L @ 25 °C (est)
Appearance	Oil
Application	Dl-Mevalonolactone serves as a critical tool for investigating various biochemical processes. It is used to study the effect of statins on the prenylation of Ras and Rho GTPases, analyze isoprenoid biosynthesis pathways in Listeria monocytogenes, and examine the effects of statins on the proliferation and migration of human umbilical vein endothelial cells. As the δ-lactone form of mevalonic acid, a precursor in the mevalonate pathway, Dl-Mevalonolactone plays a vital role in cellular metabolism. It affects biological functions such as mitochondrial depolarization and swelling, alters key enzyme activities, and modulates oxidative stress markers in brain mitochondria. Additionally, this compound counteracts the decrease in glucose uptake induced by simvastatin in myotube cells. Its relevance is highlighted in medical conditions like mevalonic aciduria, where tissue levels and urinary excretion are increased due to deficient mevalonic kinase activity.
Storage	-20 °C
Physical State	Oil
Refractive Index	n20/D 1.473(lit.)