3,4-Dimethoxycinnamic Acid
Request a quote| Catalog Number | ACM2316269 |
| Product Name | 3,4-Dimethoxycinnamic Acid |
| CAS Number | 2316-26-9 |
| Structure |  |
| Description | 3,4-Dimethoxycinnamic acid (O-Methylferulic acid) is a monomer extracted and purified from Securidaca inappendiculata Hassk. 3,4-Dimethoxycinnamic acid exerts anti-apoptotic effects on L-02 cells via the ROS-mediated signaling pathway. Anti-apoptotic effects. |
| IUPAC Name | (E)-3-(3,4-Dimethoxyphenyl)prop-2-enoic acid |
| Synonyms | Methylferulic acid |
| Molecular Weight | 208.21 |
| Molecular Formula | C11H12O4 |
| Canonical SMILES | COC1=C(C=C(C=C1)C=CC(=O)O)OC |
| Inchi | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| Boiling Point | 267.4 °C |
| Melting Point | 181-183 °C(lit.) |
| Purity | 98% |
| Density | 1.0627 g/cm³ |
| Solubility | Soluble in dichloromethane, chloroform |
| Appearance | Solid |
| Storage | Sealed in dry, room temperature |
| Refractive Index | 1.4389 |
Ask Your Question
