Diisobutyl adipate
Request a quote| Catalog Number | ACM141048-2 |
| Product Name | Diisobutyl adipate |
| CAS Number | 141-04-8 |
| Structure |  |
| Description | Diisobutyl adipate is a bis(2-methylpropyl) ester of adipic acid that is used as a plasticizer and a fatty acid in synthetic oils. |
| IUPAC Name | bis(2-methylpropyl) hexanedioate |
| Synonyms | Hexanedioic acid 1,6-bis(2-methylpropyl) ester, NSC 6343 |
| Molecular Weight | 258.35 |
| Molecular Formula | C14H26O4 |
| Canonical SMILES | CC(C)COC(=O)CCCCC(=O)OCC(C)C |
| Inchi | 1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | RDOFJDLLWVCMRU-UHFFFAOYSA-N |
| Boiling Point | 293 °C (lit.) |
| Melting Point | -17°C |
| Flash Point | >110°C |
| Purity | 99% |
| Density | 0.954 |
| Solubility | Sol in most org solvents; insol in water;Practically insoluble or insoluble in water;Soluble (in ethanol) |
| Appearance | White crystal |
| Application | This product is suitable for scientific research. |
| Physical State | Liquid |
| Refractive Index | 1.432 |
Ask Your Question
