Dihydrocoumarin
Request a quote| Catalog Number | ACM119846 |
| Product Name | Dihydrocoumarin |
| CAS Number | 119-84-6 |
| Structure |  |
| Description | Dihydrocoumarin is a compound found in Melilotus officinalis. Dihydrocoumarin is a yeast Sir2p inhibitor. Dihydrocoumarin also inhibits human SIRT1 and SIRT2 with IC50s of 208 μM and 295 μM, respectively. |
| IUPAC Name | 3,4-dihydrochromen-2-one |
| Synonyms | 3,4-Dihydrocoumarin |
| Molecular Weight | 148.16 |
| Molecular Formula | C9H8O2 |
| Canonical SMILES | C1CC(=O)OC2=CC=CC=C21 |
| Inchi | VMUXSMXIQBNMGZ-UHFFFAOYSA-N |
| InChIKey | InChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2 |
| Boiling Point | 272 °C (lit.) |
| Melting Point | 24-25 °C (lit.) |
| Purity | 99% |
| Density | 1.169g/ml |
| Physical State | Solid/Liquid |
Ask Your Question
