Diethyl adipate
Request a quote| Catalog Number | ACM141286-2 |
| Product Name | Diethyl adipate |
| CAS Number | 141-28-6 |
| Structure |  |
| Description | DBS can be used as a plasticizer for the formation of ethylcellulose based coating membranes which can be potentially used in drug delivery systems. It may also be used as a plasticizer during the fabrication of electronic artificial tongue sensors for analyzing the intensity of olive oils. |
| IUPAC Name | Diethyl hexanedioate |
| Synonyms | Adipic acid, diethyl ester;Hexanedioic acid, 1,6-diethyl ester;Hexanedioic acid, diethyl ester |
| Molecular Weight | 202.25 |
| Molecular Formula | C10H18O4 |
| Canonical SMILES | CCOC(=O)CCCCC(=O)OCC |
| Inchi | VIZORQUEIQEFRT-UHFFFAOYSA-N |
| InChIKey | InChI=1S/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-8H2,1-2H3 |
| Boiling Point | 251 °C(lit.) |
| Melting Point | -20~-19 °C(lit.) |
| Flash Point | 111.4°C |
| Purity | ≥ 97% |
| Density | 1.01g/ml |
| Solubility | 0.02 M;Soluble in ethanol and ethyl ether;In water, 4230 mg/l @ 20 °C |
| Appearance | Colorless liquid |
| Application | This product is suitable for scientific research. |
| Physical State | Liquid |
| Refractive Index | 1.426-1.428 |
Ask Your Question
