Dibutyl sebacate
Request a quote| Catalog Number | ACM109433-1 |
| Product Name | Dibutyl sebacate |
| CAS Number | 109-43-3 |
| Structure |  |
| Description | Dibutyl sebacate(DBS) is a lipophilic dibutyl ester that can be used as a plasticizer with low solubility in water. |
| IUPAC Name | Dibutyl decanedioate |
| Synonyms | Dibutyl-1,10-decanedioate |
| Molecular Weight | 314.46 |
| Molecular Formula | C18H34O4 |
| Canonical SMILES | CCCCOC(=O)CCCCCCCCC(=O)OCCCC |
| Inchi | InChI=1S/C18H34O4/c1-3-5-15-21-17(19)13-11-9-7-8-10-12-14-18(20)22-16-6-4-2/h3-16H2,1-2H3 |
| InChIKey | PYGXAGIECVVIOZ-UHFFFAOYSA-N |
| Boiling Point | 178-179 °C/3 mmHg(lit.) |
| Melting Point | 205 °C(lit.) |
| Flash Point | >230 °F |
| Purity | 98%+ |
| Density | 0.94 g/cm³ |
| Solubility | Soluble in ethyl ether |
| Appearance | Liquid |
| Application | DBS can be used as a plasticizer for the formation of ethylcellulose based coating membranes which can be potentially used in drug delivery systems. It may also be used as a plasticizer during the fabrication of electronic artificial tongue sensors for analyzing the intensity of olive oils. |
| Storage | Sealed in dry, room temperature |
| Physical State | Liquid |
| Refractive Index | n20/D 1.441(lit.) |
Ask Your Question
