3,5-Di-Tert-Butylphenol
Request a quote| Catalog Number | ACM1138529 |
| Product Name | 3,5-Di-Tert-Butylphenol |
| CAS Number | 1138-52-9 |
| Structure |  |
| Description | 3,5-Di-tert-butylphenol is an volatile organic compound with anti-biofilm and antifungal activities. 3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species (ROS). |
| IUPAC Name | 3,5-Di-tert-butylphenol |
| Synonyms | 3,5-ditert-butylphenol |
| Molecular Weight | 206.32 |
| Molecular Formula | C14H22O |
| Canonical SMILES | OC1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| Boiling Point | 276.7ºC at 760mmHg |
| Melting Point | 87-89°C(lit.) |
| Flash Point | 127.2ºC |
| Purity | 95%+ |
| Density | 0.932g/cm³ |
| Appearance | off-white crystals or powder |
| Storage | 4°C, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (stored under nitrogen). |
Ask Your Question
