3,3'-Di-O-Methylellagic Acid
Request a quote| Catalog Number | ACM2239885 |
| Product Name | 3,3'-Di-O-Methylellagic Acid |
| CAS Number | 2239-88-5 |
| Structure |  |
| Description | 3,3'-Di-O-methylellagic acid obtained from Euphorbia adenochlora selectively inhibits the formation of acid-fastness in mycobacteria without retardation of their growth. 3,3'-di-O-methylellagic acid as a hepatoprotective compound is apparently due to its antioxidative effect. |
| IUPAC Name | 6,13-Dihydroxy-7,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Synonyms | 2,7-Dihydroxy-3,8-dimethoxy-4,9-dioxapyrene-5,10-dione |
| Molecular Weight | 330.25 |
| Molecular Formula | C16H10O8 |
| Canonical SMILES | COC1=C(C=C2C3=C1OC(=O)C4=CC(=C(C(=C43)OC2=O)OC)O)O |
| Inchi | InChI=1S/C16H10O8/c1-21-11-7(17)3-5-9-10-6(15(19)23-13(9)11)4-8(18)12(22-2)14(10)24-16(5)20/h3-4,17-18H,1-2H3 |
| InChIKey | KLAGYIBJNXLDTL-UHFFFAOYSA-N |
| Boiling Point | 675.2±55.0 °C |
| Melting Point | 330-331 °C |
| Purity | 98% |
| Density | 1.673±0.06 g/ml |
| Appearance | Solid |
| Storage | 4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light). |
Ask Your Question
