Deoxypodophyllotoxin
Request a quote| Catalog Number | ACM19186357 |
| Product Name | Deoxypodophyllotoxin |
| CAS Number | 19186-35-7 |
| Structure |  |
| Description | Deoxypodophyllotoxin (DPT), a derivative of podophyllotoxin, is a lignan with potent antimitotic, anti-inflammatory and antiviral properties isolated from Anthriscus sylvestris. Deoxypodophyllotoxin, targets the microtubule, has a major impact in oncology not only as anti-mitotics but also as potent inhibitors of angiogenesis. Deoxypodophyllotoxin induces cell autophagy and apoptosis. Deoxypodophyllotoxin evokes increase of intracellular Ca2+ concentrations in DRG neurons. |
| IUPAC Name | (5R,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| Molecular Weight | 398.4 |
| Molecular Formula | C22H22O7 |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C2C3C(CC4=CC5=C(C=C24)OCO5)COC3=O |
| Inchi | InChI=1S/C22H22O7/c1-24-17-6-12(7-18(25-2)21(17)26-3)19-14-8-16-15(28-10-29-16)5-11(14)4-13-9-27-22(23)20(13)19/h5-8,13,19-20H,4,9-10H2,1-3H3/t13-,19+,20-/m0/s1 |
| InChIKey | ZGLXUQQMLLIKAN-SVIJTADQSA-N |
| Purity | 98% |
| Appearance | Powder |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
