D-Pinitol
Request a quote| Catalog Number | ACM10284636 |
| CAS | 10284-63-6 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/10284-63-6.gif) |
| Description | D-pinitol (3-O-Methyl-D-chiro-inositol) is a natural compound presented in several plants, like Pinaceae and Leguminosae plants. D-pinitol exerts hypoglycemic activity and protective effects in the cardiovascular system. D-pinitol has antiviral and larvicidal activities. |
| IUPAC Name | (1S,2S,4S,5R)-6-Methoxycyclohexane-1,2,3,4,5-pentol |
| Synonyms | Pinit |
| Molecular Weight | 194.18 |
| Molecular Formula | C7H14O6 |
| Canonical SMILES | COC1C(C(C(C(C1O)O)O)O)O |
| Inchi | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4-,5-,6+,7?/m0/s1 |
| InChIKey | DSCFFEYYQKSRSV-FEPQRWDDSA-N |
| Boiling Point | 250.62 °C |
| Melting Point | 179-185 °C(lit.) |
| Flash Point | 145.6 °C |
| Purity | 98% |
| Density | 1.2501 g/cm³ |
| Solubility | Soluble in water |
| Appearance | Powder to crystal |
| Storage | Sealed in dry, room temperature |
| Refractive Index | 1.5600 |
Ask Your Question
