Citronellal
Request a quote| Catalog Number | ACM106230 |
| Product Name | Citronellal |
| CAS Number | 106-23-0 |
| Structure |  |
| IUPAC Name | 3,7-Dimethyloct-6-enal |
| Synonyms | 3,7-Dimethyl-6-octena |
| Molecular Weight | 154.25 |
| Molecular Formula | C10H18O |
| Canonical SMILES | CC(CCC=C(C)C)CC=O |
| Inchi | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| InChIKey | NEHNMFOYXAPHSD-UHFFFAOYSA-N |
| Boiling Point | 207 °C |
| Melting Point | -16 °C |
| Flash Point | 169 °F |
| Purity | 90%+ |
| Density | 0.857 g/mL at 25 °C(lit.) |
| Solubility | Slightly miscible with water and ethanol |
| Appearance | Clear light yellow liquid |
| Physical State | Liquid |
| Refractive Index | n20/D 1.451(lit.) |
Ask Your Question
