Cassiaside B
Request a quote| Catalog Number | ACM119170513 |
| Product Name | Cassiaside B |
| CAS Number | 119170-51-3 |
| Structure |  |
| Description | Cassiaside B, a naphthopyrone, has potent antimicrobial activity. |
| Molecular Weight | 566.51 |
| Molecular Formula | C26H30O14 |
| Canonical SMILES | OC1=C2C(OC(C)=CC2=O)=CC3=C1C(O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO[C@H](OC[C@@](O)5CO)[C@@H]5O)=CC(OC)=C3 |
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
Ask Your Question
