Buparvaquone
Request a quote| Catalog Number | ACM88426339 |
| Product Name | Buparvaquone |
| CAS Number | 88426-33-9 |
| Structure |  |
| Description | Buparvaquone is a hydroxynaphthoquinone antiprotozoal agent related to parvaquone and atovaquone. |
| IUPAC Name | 3-[(4-tert-butylcyclohexyl)methyl]-4-hydroxynaphthalene-1,2-dione |
| Synonyms | 1,4-Naphthalenedione, 2-[[4-(1,1-Dimethylethyl)Cyclohexyl]Methyl]-3-Hydroxy- |
| Molecular Weight | 326.43 |
| Molecular Formula | C21H26O3 |
| Canonical SMILES | CC(C)(C)C1CCC(CC1)CC2=C(C3=CC=CC=C3C(=O)C2=O)O |
| Inchi | InChI=1S/C21H26O3/c1-21(2,3)14-10-8-13(9-11-14)12-17-18(22)15-6-4-5-7-16(15)19(23)20(17)24/h4-7,13-14,22H,8-12H2,1-3H3 |
| InChIKey | NEGDTWQGGLJCTL-UHFFFAOYSA-N |
| Boiling Point | 460.7±45.0 °C at 760 mmHg |
| Melting Point | 178-184 ºC |
| Flash Point | 246.5±25.2 °C |
| Purity | 98% |
| Density | 1.2±0.1 g/cm3 |
| Appearance | Crystalline |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
| Refractive Index | 1.574 |
Ask Your Question
