Broussonin E
Request a quote| Catalog Number | ACM90902219 |
| Product Name | Broussonin E |
| CAS Number | 90902-21-9 |
| Structure |  |
| Description | Broussonin E is a phenolic compound and shows anti-inflammatory activity. Broussonin E can suppress inflammation by modulating macrophages activation statevia inhibiting the ERK and p38 MAPK and enhancing JAK2-STAT3 signaling pathway. Broussonin E can be used for the research of inflammation-related diseases such as atherosclerosis. |
| IUPAC Name | 5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| Molecular Weight | 288.3 |
| Molecular Formula | C17H20O4 |
| Canonical SMILES | COC1=CC(=C(C=C1)CCCC2=CC(=C(C=C2)OC)O)O |
| Inchi | InChI=1S/C17H20O4/c1-20-14-8-7-13(15(18)11-14)5-3-4-12-6-9-17(21-2)16(19)10-12/h6-11,18-19H,3-5H2,1-2H3 |
| InChIKey | GDCSYNUJDYRGRF-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
