Benzophenone
Request a quote| Catalog Number | ACM119619-2 |
| Product Name | Benzophenone |
| CAS Number | 119-61-9 |
| Structure |  |
| Description | Benzophenone is the organic compound with the formula (C6H5)2CO, generally abbreviated Ph2CO. Benzophenone is a widely used building block in organic chemistry, being the parent diarylketone. |
| IUPAC Name | Diphenylmethanone |
| Synonyms | Dipheny ketone |
| Molecular Weight | 182.22 |
| Molecular Formula | C13H10O |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Inchi | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Boiling Point | 305 °C |
| Melting Point | 47-51 °C |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 1.11 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water and glycerol; slightly soluble in propylene glycol; soluble in oils |
| Appearance | Orange crystals |
| Application | Benzophenone is mainly used as a photoinitiator molecule in a variety of 3D printing s. It has a high quantum yield that makes it useful in the development of UV curable photopolymers. |
| Physical State | Crystalline powder |
| Refractive Index | n20/D 1.5893(lit.) |
Ask Your Question
